C12H15Cl2NO — CID 115647773
2-[(2,5-dichlorophenyl)methyl-prop-2-enylamino]ethanol (PubChem CID 115647773) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl-prop-2-enylamino]ethanol.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 115647773 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c1-2-5-15(6-7-16)9-10-8-11(13)3-4-12(10)14/h2-4,8,16H,1,5-7,9H2 |
| InChIKey | BHLBOYZGTHABPW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|