C16H20Cl3N — CID 88673290
(2,4-dichlorophenyl)methyl-tris(prop-2-enyl)azanium chloride (PubChem CID 88673290) has the molecular formula C16H20Cl3N and a molecular weight of 332.70 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl-tris(prop-2-enyl)azanium chloride.
| Compound Name | (2,4-dichlorophenyl)methyl-tris(prop-2-enyl)azanium chloride |
|---|---|
| PubChem CID | 88673290 |
| Molecular Formula | C16H20Cl3N |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2,4-dichlorophenyl)methyl-tris(prop-2-enyl)azanium chloride |
| SMILES | C=CC[N+](CC=C)(CC=C)Cc1ccc(Cl)cc1Cl.[Cl-] |
| InChI | InChI=1S/C16H20Cl2N.ClH/c1-4-9-19(10-5-2,11-6-3)13-14-7-8-15(17)12-16(14)18;/h4-8,12H,1-3,9-11,13H2;1H/q+1;/p-1 |
| InChIKey | GDFKKZNEKBNCCU-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|