C16H19Cl5N2 — CID 175176503
bis(2-(2,4-dichlorophenyl)ethanamine);hydrochloride (PubChem CID 175176503) has the molecular formula C16H19Cl5N2 and a molecular weight of 416.61 g/mol. Its IUPAC name is bis(2-(2,4-dichlorophenyl)ethanamine);hydrochloride.
| Compound Name | bis(2-(2,4-dichlorophenyl)ethanamine);hydrochloride |
|---|---|
| PubChem CID | 175176503 |
| Molecular Formula | C16H19Cl5N2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | bis(2-(2,4-dichlorophenyl)ethanamine);hydrochloride |
| SMILES | Cl.NCCc1ccc(Cl)cc1Cl.NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/2C8H9Cl2N.ClH/c2*9-7-2-1-6(3-4-11)8(10)5-7;/h2*1-2,5H,3-4,11H2;1H |
| InChIKey | MSBBQBYLONXVJU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |