C10H10Cl2 — CID 70272980
1-but-2-enyl-2,4-dichlorobenzene (PubChem CID 70272980) has the molecular formula C10H10Cl2 and a molecular weight of 201.10 g/mol. Its IUPAC name is 1-but-2-enyl-2,4-dichlorobenzene.
| Compound Name | 1-but-2-enyl-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 70272980 |
| Molecular Formula | C10H10Cl2 |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1-but-2-enyl-2,4-dichlorobenzene |
| SMILES | CC=CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h2-3,5-7H,4H2,1H3 |
| InChIKey | YYJMUOCPESEDEU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|