C10H10Cl2O — CID 92532445
2-[(Z)-but-2-enyl]-4,6-dichlorophenol (PubChem CID 92532445) has the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]-4,6-dichlorophenol.
| Compound Name | 2-[(Z)-but-2-enyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 92532445 |
| Molecular Formula | C10H10Cl2O |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2-[(Z)-but-2-enyl]-4,6-dichlorophenol |
| SMILES | C/C=C\Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H10Cl2O/c1-2-3-4-7-5-8(11)6-9(12)10(7)13/h2-3,5-6,13H,4H2,1H3/b3-2- |
| InChIKey | KJEMPNIRZOKIEU-IHWYPQMZSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|