C9H11Cl2NO2 — CID 82710474
2,4-dichloro-6-[(ethoxyamino)methyl]phenol (PubChem CID 82710474) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 2,4-dichloro-6-[(ethoxyamino)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(ethoxyamino)methyl]phenol |
|---|---|
| PubChem CID | 82710474 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2,4-dichloro-6-[(ethoxyamino)methyl]phenol |
| SMILES | CCONCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C9H11Cl2NO2/c1-2-14-12-5-6-3-7(10)4-8(11)9(6)13/h3-4,12-13H,2,5H2,1H3 |
| InChIKey | YUQSLQNBWGDGSI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|