C11H13Cl2NO — CID 115635121
2,4-dichloro-6-[[(1-methylcyclopropyl)amino]methyl]phenol (PubChem CID 115635121) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(1-methylcyclopropyl)amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(1-methylcyclopropyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115635121 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2,4-dichloro-6-[[(1-methylcyclopropyl)amino]methyl]phenol |
| SMILES | CC1(NCc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C11H13Cl2NO/c1-11(2-3-11)14-6-7-4-8(12)5-9(13)10(7)15/h4-5,14-15H,2-3,6H2,1H3 |
| InChIKey | ASPQZHRMZOHUGT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|