C17H25Cl2NO — CID 103965532
2,4-dichloro-6-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]phenol (PubChem CID 103965532) has the molecular formula C17H25Cl2NO and a molecular weight of 330.30 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 103965532 |
| Molecular Formula | C17H25Cl2NO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2,4-dichloro-6-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]phenol |
| SMILES | CC1(C)CC(NCc2cc(Cl)cc(Cl)c2O)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25Cl2NO/c1-16(2)7-13(8-17(3,4)10-16)20-9-11-5-12(18)6-14(19)15(11)21/h5-6,13,20-21H,7-10H2,1-4H3 |
| InChIKey | FQJDUSFPZJBEBW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|