C17H27NO2 — CID 103965652
3-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]benzene-1,2-diol (PubChem CID 103965652) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 103965652 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]benzene-1,2-diol |
| SMILES | CC1(C)CC(NCc2cccc(O)c2O)CC(C)(C)C1 |
| InChI | InChI=1S/C17H27NO2/c1-16(2)8-13(9-17(3,4)11-16)18-10-12-6-5-7-14(19)15(12)20/h5-7,13,18-20H,8-11H2,1-4H3 |
| InChIKey | DJYCDLTVUVHUHX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|