C19H28N2 — CID 103965535
N-(1H-indol-3-ylmethyl)-3,3,5,5-tetramethylcyclohexan-1-amine (PubChem CID 103965535) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-(1H-indol-3-ylmethyl)-3,3,5,5-tetramethylcyclohexan-1-amine.
| Compound Name | N-(1H-indol-3-ylmethyl)-3,3,5,5-tetramethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103965535 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-(1H-indol-3-ylmethyl)-3,3,5,5-tetramethylcyclohexan-1-amine |
| SMILES | CC1(C)CC(NCc2c[nH]c3ccccc23)CC(C)(C)C1 |
| InChI | InChI=1S/C19H28N2/c1-18(2)9-15(10-19(3,4)13-18)20-11-14-12-21-17-8-6-5-7-16(14)17/h5-8,12,15,20-21H,9-11,13H2,1-4H3 |
| InChIKey | JGVGYIVAAVRODY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |