C17H24N2 — CID 62407326
1-cyclohexyl-N-(1H-indol-3-ylmethyl)ethanamine (PubChem CID 62407326) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-cyclohexyl-N-(1H-indol-3-ylmethyl)ethanamine.
| Compound Name | 1-cyclohexyl-N-(1H-indol-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62407326 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-cyclohexyl-N-(1H-indol-3-ylmethyl)ethanamine |
| SMILES | CC(NCc1c[nH]c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C17H24N2/c1-13(14-7-3-2-4-8-14)18-11-15-12-19-17-10-6-5-9-16(15)17/h5-6,9-10,12-14,18-19H,2-4,7-8,11H2,1H3 |
| InChIKey | NCIALMJVRXRQAO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |