C19H25NO — CID 81388297
1-[[[(1R)-1-cyclohexylethyl]amino]methyl]naphthalen-2-ol (PubChem CID 81388297) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-[[[(1R)-1-cyclohexylethyl]amino]methyl]naphthalen-2-ol.
| Compound Name | 1-[[[(1R)-1-cyclohexylethyl]amino]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 81388297 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-[[[(1R)-1-cyclohexylethyl]amino]methyl]naphthalen-2-ol |
| SMILES | C[C@@H](NCc1c(O)ccc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C19H25NO/c1-14(15-7-3-2-4-8-15)20-13-18-17-10-6-5-9-16(17)11-12-19(18)21/h5-6,9-12,14-15,20-21H,2-4,7-8,13H2,1H3/t14-/m1/s1 |
| InChIKey | SYLJZBHNORXVIU-CQSZACIVSA-N |
| XLogP | 4.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|