C11H15N3 — CID 83003617
2-(1H-indol-3-ylmethyl)-1,1-dimethylhydrazine (PubChem CID 83003617) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(1H-indol-3-ylmethyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(1H-indol-3-ylmethyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83003617 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(1H-indol-3-ylmethyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H15N3/c1-14(2)13-8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12-13H,8H2,1-2H3 |
| InChIKey | IKRHBSGFXOYSRH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|