About 3-ethyl-1H-indole;methanamine
3-ethyl-1H-indole;methanamine (PubChem CID 142222050) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethyl-1H-indole;methanamine.
Molecular Properties
| Compound Name | 3-ethyl-1H-indole;methanamine |
| PubChem CID | 142222050 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-ethyl-1H-indole;methanamine |
| SMILES | CCc1c[nH]c2ccccc12.CN |
| InChI | InChI=1S/C10H11N.CH5N/c1-2-8-7-11-10-6-4-3-5-9(8)10;1-2/h3-7,11H,2H2,1H3;2H2,1H3 |
| InChIKey | OZVOUSZYVGBJIP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1H-indole;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1H-indole;methanamine?
The IUPAC name of 3-ethyl-1H-indole;methanamine (CID 142222050) is 3-ethyl-1H-indole;methanamine.
What is the SMILES notation for 3-ethyl-1H-indole;methanamine?
The canonical SMILES for 3-ethyl-1H-indole;methanamine is CCc1c[nH]c2ccccc12.CN.
What is the InChIKey of 3-ethyl-1H-indole;methanamine?
The InChIKey is OZVOUSZYVGBJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.CH5N/c1-2-8-7-11-10-6-4-3-5-9(8)10;1-2/h3-7,11H,2H2,1H3;2H2,1H3.
What are the key properties of 3-ethyl-1H-indole;methanamine?
3-ethyl-1H-indole;methanamine has a molecular weight of 176.26 g/mol, XLogP of 2.31, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1H-indole;methanamine is sourced from PubChem (CID 142222050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).