About 1H-indol-3-ylmethanamine;hydrochloride
1H-indol-3-ylmethanamine;hydrochloride (PubChem CID 52986033) has the molecular formula C9H11ClN2
and a molecular weight of 182.65 g/mol. Its IUPAC name is 1H-indol-3-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1H-indol-3-ylmethanamine;hydrochloride |
| PubChem CID | 52986033 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1H-indol-3-ylmethanamine;hydrochloride |
| SMILES | Cl.NCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H10N2.ClH/c10-5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6,11H,5,10H2;1H |
| InChIKey | GOWCWBKBWLNFCM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indol-3-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-ylmethanamine;hydrochloride?
The IUPAC name of 1H-indol-3-ylmethanamine;hydrochloride (CID 52986033) is 1H-indol-3-ylmethanamine;hydrochloride.
What is the SMILES notation for 1H-indol-3-ylmethanamine;hydrochloride?
The canonical SMILES for 1H-indol-3-ylmethanamine;hydrochloride is Cl.NCc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-ylmethanamine;hydrochloride?
The InChIKey is GOWCWBKBWLNFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.ClH/c10-5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6,11H,5,10H2;1H.
What are the key properties of 1H-indol-3-ylmethanamine;hydrochloride?
1H-indol-3-ylmethanamine;hydrochloride has a molecular weight of 182.65 g/mol, XLogP of 2.05, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-ylmethanamine;hydrochloride is sourced from PubChem (CID 52986033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).