About 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite
2-(1H-indol-3-yl)ethanamine;methyl hypoiodite (PubChem CID 143451156) has the molecular formula C11H15IN2O
and a molecular weight of 318.16 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite |
| PubChem CID | 143451156 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite |
| SMILES | COI.NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H12N2.CH3IO/c11-6-5-8-7-12-10-4-2-1-3-9(8)10;1-3-2/h1-4,7,12H,5-6,11H2;1H3 |
| InChIKey | JSFQLOJZHHBDQF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite?
The IUPAC name of 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite (CID 143451156) is 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite.
What is the SMILES notation for 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite?
The canonical SMILES for 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite is COI.NCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite?
The InChIKey is JSFQLOJZHHBDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.CH3IO/c11-6-5-8-7-12-10-4-2-1-3-9(8)10;1-3-2/h1-4,7,12H,5-6,11H2;1H3.
What are the key properties of 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite?
2-(1H-indol-3-yl)ethanamine;methyl hypoiodite has a molecular weight of 318.16 g/mol, XLogP of 2.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)ethanamine;methyl hypoiodite is sourced from PubChem (CID 143451156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).