C21H22N4O2 — CID 57497989
[3-(2-aminoethyl)-1H-indol-5-yl] (2S)-2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 57497989) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is [3-(2-aminoethyl)-1H-indol-5-yl] (2S)-2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | [3-(2-aminoethyl)-1H-indol-5-yl] (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 57497989 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [3-(2-aminoethyl)-1H-indol-5-yl] (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | NCCc1c[nH]c2ccc(OC(=O)[C@@H](N)Cc3c[nH]c4ccccc34)cc12 |
| InChI | InChI=1S/C21H22N4O2/c22-8-7-13-11-24-20-6-5-15(10-17(13)20)27-21(26)18(23)9-14-12-25-19-4-2-1-3-16(14)19/h1-6,10-12,18,24-25H,7-9,22-23H2/t18-/m0/s1 |
| InChIKey | SMYVRJZMJZIGMS-SFHVURJKSA-N |
| XLogP | 2.63 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|