C26H30N4O4 — CID 57477029
bis[3-(2-aminoethyl)-1H-indol-5-yl] hexanedioate (PubChem CID 57477029) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is bis[3-(2-aminoethyl)-1H-indol-5-yl] hexanedioate.
| Compound Name | bis[3-(2-aminoethyl)-1H-indol-5-yl] hexanedioate |
|---|---|
| PubChem CID | 57477029 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | bis[3-(2-aminoethyl)-1H-indol-5-yl] hexanedioate |
| SMILES | NCCc1c[nH]c2ccc(OC(=O)CCCCC(=O)Oc3ccc4[nH]cc(CCN)c4c3)cc12 |
| InChI | InChI=1S/C26H30N4O4/c27-11-9-17-15-29-23-7-5-19(13-21(17)23)33-25(31)3-1-2-4-26(32)34-20-6-8-24-22(14-20)18(10-12-28)16-30-24/h5-8,13-16,29-30H,1-4,9-12,27-28H2 |
| InChIKey | BGQRSOFRUWHGPS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 136.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|