C16H23ClN2O2 — CID 67642487
[3-(2-aminoethyl)-1H-indol-5-yl] hexanoate;hydrochloride (PubChem CID 67642487) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is [3-(2-aminoethyl)-1H-indol-5-yl] hexanoate;hydrochloride.
| Compound Name | [3-(2-aminoethyl)-1H-indol-5-yl] hexanoate;hydrochloride |
|---|---|
| PubChem CID | 67642487 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [3-(2-aminoethyl)-1H-indol-5-yl] hexanoate;hydrochloride |
| SMILES | CCCCCC(=O)Oc1ccc2[nH]cc(CCN)c2c1.Cl |
| InChI | InChI=1S/C16H22N2O2.ClH/c1-2-3-4-5-16(19)20-13-6-7-15-14(10-13)12(8-9-17)11-18-15;/h6-7,10-11,18H,2-5,8-9,17H2,1H3;1H |
| InChIKey | ABNBZOSEBBLQTJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|