C28H28Cl2N4O4 — CID 44783815
bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,3-dicarboxylate;dihydrochloride (PubChem CID 44783815) has the molecular formula C28H28Cl2N4O4 and a molecular weight of 555.46 g/mol. Its IUPAC name is bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,3-dicarboxylate;dihydrochloride.
| Compound Name | bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,3-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 44783815 |
| Molecular Formula | C28H28Cl2N4O4 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,3-dicarboxylate;dihydrochloride |
| SMILES | Cl.Cl.NCCc1c[nH]c2ccc(OC(=O)c3cccc(C(=O)Oc4ccc5[nH]cc(CCN)c5c4)c3)cc12 |
| InChI | InChI=1S/C28H26N4O4.2ClH/c29-10-8-19-15-31-25-6-4-21(13-23(19)25)35-27(33)17-2-1-3-18(12-17)28(34)36-22-5-7-26-24(14-22)20(9-11-30)16-32-26;;/h1-7,12-16,31-32H,8-11,29-30H2;2*1H |
| InChIKey | HTQWJRGKMCBOFP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 136.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|