C22H24ClN3O3 — CID 19029941
2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione;hydrochloride (PubChem CID 19029941) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 19029941 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.NCCc1c[nH]c2ccc(OCCCCN3C(=O)c4ccccc4C3=O)cc12 |
| InChI | InChI=1S/C22H23N3O3.ClH/c23-10-9-15-14-24-20-8-7-16(13-19(15)20)28-12-4-3-11-25-21(26)17-5-1-2-6-18(17)22(25)27;/h1-2,5-8,13-14,24H,3-4,9-12,23H2;1H |
| InChIKey | AMHVLQSOWOPTBX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|