C19H16N2O2 — CID 906585
2-[3-(1H-indol-3-yl)propyl]isoindole-1,3-dione (PubChem CID 906585) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[3-(1H-indol-3-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1H-indol-3-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 906585 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[3-(1H-indol-3-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N2O2/c22-18-15-8-1-2-9-16(15)19(23)21(18)11-5-6-13-12-20-17-10-4-3-7-14(13)17/h1-4,7-10,12,20H,5-6,11H2 |
| InChIKey | LNNLNNPQBNHWLJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|