C20H18N2O3 — CID 906584
2-[3-(5-methoxy-1H-indol-3-yl)propyl]isoindole-1,3-dione (PubChem CID 906584) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[3-(5-methoxy-1H-indol-3-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(5-methoxy-1H-indol-3-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 906584 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[3-(5-methoxy-1H-indol-3-yl)propyl]isoindole-1,3-dione |
| SMILES | COc1ccc2[nH]cc(CCCN3C(=O)c4ccccc4C3=O)c2c1 |
| InChI | InChI=1S/C20H18N2O3/c1-25-14-8-9-18-17(11-14)13(12-21-18)5-4-10-22-19(23)15-6-2-3-7-16(15)20(22)24/h2-3,6-9,11-12,21H,4-5,10H2,1H3 |
| InChIKey | XGKIRMXYDHVDBX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|