C25H22N4O4 — CID 171934294
3-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 171934294) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 3-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 171934294 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | COc1ccc2[nH]cc(CCN3C(=O)c4ccccc4NC3c3cccc([N+](=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C25H22N4O4/c1-33-19-9-10-22-21(14-19)17(15-26-22)11-12-28-24(16-5-4-6-18(13-16)29(31)32)27-23-8-3-2-7-20(23)25(28)30/h2-10,13-15,24,26-27H,11-12H2,1H3 |
| InChIKey | PNAUNGVVJGMHQH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|