C16H12F3N3O3 — CID 46613504
2-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-1,2-dihydroquinazolin-4-one (PubChem CID 46613504) has the molecular formula C16H12F3N3O3 and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 46613504 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2cccc([N+](=O)[O-])c2)N1CC(F)(F)F |
| InChI | InChI=1S/C16H12F3N3O3/c17-16(18,19)9-21-14(10-4-3-5-11(8-10)22(24)25)20-13-7-2-1-6-12(13)15(21)23/h1-8,14,20H,9H2 |
| InChIKey | ANHANQJFTJWRNK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|