C14H11N3O4 — CID 2872744
3-hydroxy-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 2872744) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-hydroxy-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-hydroxy-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 2872744 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-hydroxy-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2cccc([N+](=O)[O-])c2)N1O |
| InChI | InChI=1S/C14H11N3O4/c18-14-11-6-1-2-7-12(11)15-13(16(14)19)9-4-3-5-10(8-9)17(20)21/h1-8,13,15,19H |
| InChIKey | PLMQFSYKWPUFMJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|