C21H16FN3O3 — CID 41064113
(2R)-3-[(4-fluorophenyl)methyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 41064113) has the molecular formula C21H16FN3O3 and a molecular weight of 377.38 g/mol. Its IUPAC name is (2R)-3-[(4-fluorophenyl)methyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-[(4-fluorophenyl)methyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 41064113 |
| Molecular Formula | C21H16FN3O3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (2R)-3-[(4-fluorophenyl)methyl]-2-(3-nitrophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2cccc([N+](=O)[O-])c2)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16FN3O3/c22-16-10-8-14(9-11-16)13-24-20(15-4-3-5-17(12-15)25(27)28)23-19-7-2-1-6-18(19)21(24)26/h1-12,20,23H,13H2/t20-/m1/s1 |
| InChIKey | SNURTYIDUMHJSY-HXUWFJFHSA-N |
| XLogP | 4.50 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|