C26H21N5O5 — CID 51718753
(4R)-3-(furan-2-yl)-5-[2-(5-methoxy-1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 51718753) has the molecular formula C26H21N5O5 and a molecular weight of 483.48 g/mol. Its IUPAC name is (4R)-3-(furan-2-yl)-5-[2-(5-methoxy-1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | (4R)-3-(furan-2-yl)-5-[2-(5-methoxy-1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 51718753 |
| Molecular Formula | C26H21N5O5 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (4R)-3-(furan-2-yl)-5-[2-(5-methoxy-1H-indol-3-yl)ethyl]-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | COc1ccc2[nH]cc(CCN3C(=O)c4n[nH]c(-c5ccco5)c4[C@H]3c3ccc([N+](=O)[O-])cc3)c2c1 |
| InChI | InChI=1S/C26H21N5O5/c1-35-18-8-9-20-19(13-18)16(14-27-20)10-11-30-25(15-4-6-17(7-5-15)31(33)34)22-23(21-3-2-12-36-21)28-29-24(22)26(30)32/h2-9,12-14,25,27H,10-11H2,1H3,(H,28,29)/t25-/m1/s1 |
| InChIKey | IKBVOIXQMOKOFK-RUZDIDTESA-N |
| XLogP | 4.86 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|