C18H16N4O5 — CID 29139185
(4S)-3-(furan-2-yl)-5-(2-methoxyethyl)-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 29139185) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is (4S)-3-(furan-2-yl)-5-(2-methoxyethyl)-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | (4S)-3-(furan-2-yl)-5-(2-methoxyethyl)-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 29139185 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (4S)-3-(furan-2-yl)-5-(2-methoxyethyl)-4-(4-nitrophenyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | COCCN1C(=O)c2n[nH]c(-c3ccco3)c2[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N4O5/c1-26-10-8-21-17(11-4-6-12(7-5-11)22(24)25)14-15(13-3-2-9-27-13)19-20-16(14)18(21)23/h2-7,9,17H,8,10H2,1H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | BNZJGZNFLPVPKA-KRWDZBQOSA-N |
| XLogP | 2.77 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|