C26H29N3O3 — CID 22875366
2-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione (PubChem CID 22875366) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22875366 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]isoindole-1,3-dione |
| SMILES | CN1CCC[C@H]1Cc1c[nH]c2ccc(OCCCCN3C(=O)c4ccccc4C3=O)cc12 |
| InChI | InChI=1S/C26H29N3O3/c1-28-12-6-7-19(28)15-18-17-27-24-11-10-20(16-23(18)24)32-14-5-4-13-29-25(30)21-8-2-3-9-22(21)26(29)31/h2-3,8-11,16-17,19,27H,4-7,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | CXQHRWZLRXEZLB-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|