C29H45N5O5 — CID 173328235
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]carbamate (PubChem CID 173328235) has the molecular formula C29H45N5O5 and a molecular weight of 543.71 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]carbamate |
|---|---|
| PubChem CID | 173328235 |
| Molecular Formula | C29H45N5O5 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[4-[[3-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]butyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CCCCOc1ccc2[nH]cc(C[C@@H]3CCCN3C)c2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H45N5O5/c1-28(2,3)38-26(35)32-25(30)34(27(36)39-29(4,5)6)15-8-9-16-37-22-12-13-24-23(18-22)20(19-31-24)17-21-11-10-14-33(21)7/h12-13,18-19,21,31H,8-11,14-17H2,1-7H3,(H2,30,32,35)/t21-/m0/s1 |
| InChIKey | YDZOBUNLNZDJHR-NRFANRHFSA-N |
| XLogP | 5.66 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|