C14H17FN2 — CID 54476619
5-fluoro-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 54476619) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 5-fluoro-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 5-fluoro-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 54476619 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 5-fluoro-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C14H17FN2/c1-17-6-2-3-12(17)7-10-9-16-14-5-4-11(15)8-13(10)14/h4-5,8-9,12,16H,2-3,6-7H2,1H3/t12-/m1/s1 |
| InChIKey | XMAODTLZCWIQBA-GFCCVEGCSA-N |
| XLogP | 2.94 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |