C19H26N2OS — CID 176854776
3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5-(oxan-4-ylsulfanyl)-1H-indole (PubChem CID 176854776) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5-(oxan-4-ylsulfanyl)-1H-indole.
| Compound Name | 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5-(oxan-4-ylsulfanyl)-1H-indole |
|---|---|
| PubChem CID | 176854776 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-5-(oxan-4-ylsulfanyl)-1H-indole |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(SC3CCOCC3)cc12 |
| InChI | InChI=1S/C19H26N2OS/c1-21-8-2-3-15(21)11-14-13-20-19-5-4-17(12-18(14)19)23-16-6-9-22-10-7-16/h4-5,12-13,15-16,20H,2-3,6-11H2,1H3/t15-/m1/s1 |
| InChIKey | OHWVHKWLHMMVSM-OAHLLOKOSA-N |
| XLogP | 4.08 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |