C16H20N2 — CID 10220397
5-ethenyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 10220397) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-ethenyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 5-ethenyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 10220397 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-ethenyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | C=Cc1ccc2[nH]cc(C[C@H]3CCCN3C)c2c1 |
| InChI | InChI=1S/C16H20N2/c1-3-12-6-7-16-15(9-12)13(11-17-16)10-14-5-4-8-18(14)2/h3,6-7,9,11,14,17H,1,4-5,8,10H2,2H3/t14-/m1/s1 |
| InChIKey | PNFOQRUTYUZUCT-CQSZACIVSA-N |
| XLogP | 3.45 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |