C19H27N3O2S — CID 174270352
N-methyl-1-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]-1-prop-2-enylsulfonylmethanamine (PubChem CID 174270352) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-methyl-1-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]-1-prop-2-enylsulfonylmethanamine.
| Compound Name | N-methyl-1-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]-1-prop-2-enylsulfonylmethanamine |
|---|---|
| PubChem CID | 174270352 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-methyl-1-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]-1-prop-2-enylsulfonylmethanamine |
| SMILES | C=CCS(=O)(=O)C(NC)c1ccc2[nH]cc(C[C@H]3CCCN3C)c2c1 |
| InChI | InChI=1S/C19H27N3O2S/c1-4-10-25(23,24)19(20-2)14-7-8-18-17(12-14)15(13-21-18)11-16-6-5-9-22(16)3/h4,7-8,12-13,16,19-21H,1,5-6,9-11H2,2-3H3/t16-,19?/m1/s1 |
| InChIKey | ZTMYRVTWHMCAGZ-VTBWFHPJSA-N |
| XLogP | 2.62 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|