C16H22N3O2S- — CID 70284129
methylamino-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]methanesulfinate (PubChem CID 70284129) has the molecular formula C16H22N3O2S- and a molecular weight of 320.44 g/mol. Its IUPAC name is methylamino-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]methanesulfinate.
| Compound Name | methylamino-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]methanesulfinate |
|---|---|
| PubChem CID | 70284129 |
| Molecular Formula | C16H22N3O2S- |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methylamino-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]methanesulfinate |
| SMILES | CNC(c1ccc2[nH]cc(CC3CCCN3C)c2c1)S(=O)[O-] |
| InChI | InChI=1S/C16H23N3O2S/c1-17-16(22(20)21)11-5-6-15-14(9-11)12(10-18-15)8-13-4-3-7-19(13)2/h5-6,9-10,13,16-18H,3-4,7-8H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | WURISURENJMGSZ-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|