C15H21N3O3S — CID 174263324
[methyl-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]amino] hydrogen sulfite (PubChem CID 174263324) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is [methyl-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]amino] hydrogen sulfite.
| Compound Name | [methyl-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]amino] hydrogen sulfite |
|---|---|
| PubChem CID | 174263324 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [methyl-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]amino] hydrogen sulfite |
| SMILES | CN(OS(=O)O)c1ccc2[nH]cc(C[C@H]3CCCN3C)c2c1 |
| InChI | InChI=1S/C15H21N3O3S/c1-17-7-3-4-12(17)8-11-10-16-15-6-5-13(9-14(11)15)18(2)21-22(19)20/h5-6,9-10,12,16H,3-4,7-8H2,1-2H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | CCKXMXDFBQWMLE-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|