C23H26N2O2 — CID 23003773
1-(2-methoxyphenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone (PubChem CID 23003773) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone.
| Compound Name | 1-(2-methoxyphenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone |
|---|---|
| PubChem CID | 23003773 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone |
| SMILES | COc1ccccc1C(=O)Cc1ccc2[nH]cc(CC3CCCN3C)c2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-25-11-5-6-18(25)14-17-15-24-21-10-9-16(12-20(17)21)13-22(26)19-7-3-4-8-23(19)27-2/h3-4,7-10,12,15,18,24H,5-6,11,13-14H2,1-2H3 |
| InChIKey | BTQSGEPLFOOVLI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |