C18H28N3O2S- — CID 19421876
5-ethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole;[methyl(sulfinato)amino]methane (PubChem CID 19421876) has the molecular formula C18H28N3O2S- and a molecular weight of 350.51 g/mol. Its IUPAC name is 5-ethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole;[methyl(sulfinato)amino]methane.
| Compound Name | 5-ethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole;[methyl(sulfinato)amino]methane |
|---|---|
| PubChem CID | 19421876 |
| Molecular Formula | C18H28N3O2S- |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-ethyl-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole;[methyl(sulfinato)amino]methane |
| SMILES | CCc1ccc2[nH]cc(CC3CCCN3C)c2c1.CN(C)S(=O)[O-] |
| InChI | InChI=1S/C16H22N2.C2H7NO2S/c1-3-12-6-7-16-15(9-12)13(11-17-16)10-14-5-4-8-18(14)2;1-3(2)6(4)5/h6-7,9,11,14,17H,3-5,8,10H2,1-2H3;1-2H3,(H,4,5)/p-1 |
| InChIKey | DUOXSVMMEKPRJQ-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|