C22H25N3O — CID 23003804
1-(3-aminophenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone (PubChem CID 23003804) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone.
| Compound Name | 1-(3-aminophenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone |
|---|---|
| PubChem CID | 23003804 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(3-aminophenyl)-2-[3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-5-yl]ethanone |
| SMILES | CN1CCCC1Cc1c[nH]c2ccc(CC(=O)c3cccc(N)c3)cc12 |
| InChI | InChI=1S/C22H25N3O/c1-25-9-3-6-19(25)13-17-14-24-21-8-7-15(10-20(17)21)11-22(26)16-4-2-5-18(23)12-16/h2,4-5,7-8,10,12,14,19,24H,3,6,9,11,13,23H2,1H3 |
| InChIKey | APKKRSRBWDBION-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|