C20H30N2O — CID 22870340
2-methyl-5-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]pentan-2-ol (PubChem CID 22870340) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-methyl-5-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]pentan-2-ol.
| Compound Name | 2-methyl-5-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]pentan-2-ol |
|---|---|
| PubChem CID | 22870340 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-methyl-5-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-5-yl]pentan-2-ol |
| SMILES | CN1CCC[C@@H]1Cc1c[nH]c2ccc(CCCC(C)(C)O)cc12 |
| InChI | InChI=1S/C20H30N2O/c1-20(2,23)10-4-6-15-8-9-19-18(12-15)16(14-21-19)13-17-7-5-11-22(17)3/h8-9,12,14,17,21,23H,4-7,10-11,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | WZPAKNGHIOIBKH-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |