C25H30IN5O2 — CID 111826736
2-[4-(1,3-dioxoisoindol-2-yl)butyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111826736) has the molecular formula C25H30IN5O2 and a molecular weight of 559.45 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)butyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)butyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111826736 |
| Molecular Formula | C25H30IN5O2 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)butyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1C(=O)c2ccccc2C1=O)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C25H29N5O2.HI/c1-2-26-25(28-15-13-18-17-29-22-12-6-5-9-19(18)22)27-14-7-8-16-30-23(31)20-10-3-4-11-21(20)24(30)32;/h3-6,9-12,17,29H,2,7-8,13-16H2,1H3,(H2,26,27,28);1H |
| InChIKey | PVMYOJAKXSWQIG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|