C18H28IN5O2S — CID 110996204
2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 110996204) has the molecular formula C18H28IN5O2S and a molecular weight of 505.43 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110996204 |
| Molecular Formula | C18H28IN5O2S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C18H27N5O2S.HI/c1-2-19-18(21-10-12-23-11-5-13-26(23,24)25)20-9-8-15-14-22-17-7-4-3-6-16(15)17;/h3-4,6-7,14,22H,2,5,8-13H2,1H3,(H2,19,20,21);1H |
| InChIKey | NEAQNOQLGKVKRX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|