C23H25N5O2 — CID 110995331
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine (PubChem CID 110995331) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110995331 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccccc12)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H25N5O2/c1-2-24-23(25-12-11-16-15-27-20-10-6-5-7-17(16)20)26-13-14-28-21(29)18-8-3-4-9-19(18)22(28)30/h3-10,15,27H,2,11-14H2,1H3,(H2,24,25,26) |
| InChIKey | QOUUMEXWRAZTQG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|