C20H28IN5O2 — CID 111499836
1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111499836) has the molecular formula C20H28IN5O2 and a molecular weight of 497.38 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111499836 |
| Molecular Formula | C20H28IN5O2 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccccc12)NCCN1C(=O)CCCC1=O.I |
| InChI | InChI=1S/C20H27N5O2.HI/c1-2-21-20(23-12-13-25-18(26)8-5-9-19(25)27)22-11-10-15-14-24-17-7-4-3-6-16(15)17;/h3-4,6-7,14,24H,2,5,8-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | QZVJDAZGTHDKKR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|