C19H26IN5O2 — CID 111499832
1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111499832) has the molecular formula C19H26IN5O2 and a molecular weight of 483.35 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111499832 |
| Molecular Formula | C19H26IN5O2 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCCN1C(=O)CCCC1=O.I |
| InChI | InChI=1S/C19H25N5O2.HI/c1-20-19(22-11-12-24-17(25)7-4-8-18(24)26)21-10-9-14-13-23-16-6-3-2-5-15(14)16;/h2-3,5-6,13,23H,4,7-12H2,1H3,(H2,20,21,22);1H |
| InChIKey | HBPZUSOFYRWGSR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|