C20H30IN5O3S — CID 110996020
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]propanamide;hydroiodide (PubChem CID 110996020) has the molecular formula C20H30IN5O3S and a molecular weight of 547.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 110996020 |
| Molecular Formula | C20H30IN5O3S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C20H29N5O3S.HI/c1-2-21-20(22-10-7-15-13-24-18-6-4-3-5-17(15)18)23-11-8-19(26)25-16-9-12-29(27,28)14-16;/h3-6,13,16,24H,2,7-12,14H2,1H3,(H,25,26)(H2,21,22,23);1H |
| InChIKey | YIICCKYMHWFOIV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|