C18H27FN4O3S — CID 111361841
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]propanamide (PubChem CID 111361841) has the molecular formula C18H27FN4O3S and a molecular weight of 398.50 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111361841 |
| Molecular Formula | C18H27FN4O3S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NCCc1ccccc1F |
| InChI | InChI=1S/C18H27FN4O3S/c1-2-20-18(21-10-7-14-5-3-4-6-16(14)19)22-11-8-17(24)23-15-9-12-27(25,26)13-15/h3-6,15H,2,7-13H2,1H3,(H,23,24)(H2,20,21,22) |
| InChIKey | XXPGKDJZUZEFOG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|