C19H31IN4O4S — CID 111881150
N-(1,1-dioxothiolan-3-yl)-3-[[N'-[(2-ethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111881150) has the molecular formula C19H31IN4O4S and a molecular weight of 538.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-[(2-ethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-[(2-ethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111881150 |
| Molecular Formula | C19H31IN4O4S |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-[(2-ethoxyphenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OCC)NCCC(=O)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H30N4O4S.HI/c1-3-20-19(22-13-15-7-5-6-8-17(15)27-4-2)21-11-9-18(24)23-16-10-12-28(25,26)14-16;/h5-8,16H,3-4,9-14H2,1-2H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | GWBMGEIEYIYSFT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|