C19H32IN3O3S — CID 111141062
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(3-methylbutoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111141062) has the molecular formula C19H32IN3O3S and a molecular weight of 509.45 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(3-methylbutoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(3-methylbutoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141062 |
| Molecular Formula | C19H32IN3O3S |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(3-methylbutoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OCCC(C)C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H31N3O3S.HI/c1-4-20-19(22-17-10-12-26(23,24)14-17)21-13-16-7-5-6-8-18(16)25-11-9-15(2)3;/h5-8,15,17H,4,9-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | CITPVLMABJHVRA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|